C8H7Cl2FO — CID 163198260
(4,5-dichloro-2-fluoro-3-methylphenyl)methanol (PubChem CID 163198260) has the molecular formula C8H7Cl2FO and a molecular weight of 209.05 g/mol. Its IUPAC name is (4,5-dichloro-2-fluoro-3-methylphenyl)methanol.
| Compound Name | (4,5-dichloro-2-fluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 163198260 |
| Molecular Formula | C8H7Cl2FO |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | (4,5-dichloro-2-fluoro-3-methylphenyl)methanol |
| SMILES | Cc1c(F)c(CO)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl2FO/c1-4-7(10)6(9)2-5(3-12)8(4)11/h2,12H,3H2,1H3 |
| InChIKey | PTKKWVRTKGOFHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|