C9H10BrClO — CID 84803776
(3-bromo-5-chloro-2,4-dimethylphenyl)methanol (PubChem CID 84803776) has the molecular formula C9H10BrClO and a molecular weight of 249.53 g/mol. Its IUPAC name is (3-bromo-5-chloro-2,4-dimethylphenyl)methanol.
| Compound Name | (3-bromo-5-chloro-2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 84803776 |
| Molecular Formula | C9H10BrClO |
| Molecular Weight | 249.53 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | (3-bromo-5-chloro-2,4-dimethylphenyl)methanol |
| SMILES | Cc1c(Cl)cc(CO)c(C)c1Br |
| InChI | InChI=1S/C9H10BrClO/c1-5-7(4-12)3-8(11)6(2)9(5)10/h3,12H,4H2,1-2H3 |
| InChIKey | AQGFRJAWOXKWCB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |