C8H9BrClN — CID 84797130
3-bromo-5-chloro-2,4-dimethylaniline (PubChem CID 84797130) has the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. Its IUPAC name is 3-bromo-5-chloro-2,4-dimethylaniline.
| Compound Name | 3-bromo-5-chloro-2,4-dimethylaniline |
|---|---|
| PubChem CID | 84797130 |
| Molecular Formula | C8H9BrClN |
| Molecular Weight | 234.52 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 3-bromo-5-chloro-2,4-dimethylaniline |
| SMILES | Cc1c(N)cc(Cl)c(C)c1Br |
| InChI | InChI=1S/C8H9BrClN/c1-4-6(10)3-7(11)5(2)8(4)9/h3H,11H2,1-2H3 |
| InChIKey | UFRRVVXGVCXGRG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|