About 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene
1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene (PubChem CID 91417715) has the molecular formula C14H16N2S2
and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene |
| PubChem CID | 91417715 |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene |
| SMILES | Cc1c(N=C=S)cc(C(C)(C)C)c(C)c1N=C=S |
| InChI | InChI=1S/C14H16N2S2/c1-9-11(14(3,4)5)6-12(15-7-17)10(2)13(9)16-8-18/h6H,1-5H3 |
| InChIKey | FKIPDJOCILHTRR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene?
The IUPAC name of 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene (CID 91417715) is 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene.
What is the SMILES notation for 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene?
The canonical SMILES for 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene is Cc1c(N=C=S)cc(C(C)(C)C)c(C)c1N=C=S.
What is the InChIKey of 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene?
The InChIKey is FKIPDJOCILHTRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S2/c1-9-11(14(3,4)5)6-12(15-7-17)10(2)13(9)16-8-18/h6H,1-5H3.
What are the key properties of 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene?
1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene has a molecular weight of 276.43 g/mol, XLogP of 5.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-diisothiocyanato-2,4-dimethylbenzene is sourced from PubChem (CID 91417715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).