C33H52ClP — CID 546782
chloro-(2,4,6-tritert-butylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]phosphane (PubChem CID 546782) has the molecular formula C33H52ClP and a molecular weight of 515.21 g/mol. Its IUPAC name is chloro-(2,4,6-tritert-butylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]phosphane.
| Compound Name | chloro-(2,4,6-tritert-butylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 546782 |
| Molecular Formula | C33H52ClP |
| Molecular Weight | 515.21 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | chloro-(2,4,6-tritert-butylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(P(Cl)c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C33H52ClP/c1-20(2)23-16-25(21(3)4)29(26(17-23)22(5)6)35(34)30-27(32(10,11)12)18-24(31(7,8)9)19-28(30)33(13,14)15/h16-22H,1-15H3 |
| InChIKey | JLZLSKYSHGJYRM-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.21 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|