C34H56NOPS — CID 2830102
2,4,6-tritert-butyl-N-[methoxy-[2,4,6-tri(propan-2-yl)phenyl]phosphinothioyl]aniline (PubChem CID 2830102) has the molecular formula C34H56NOPS and a molecular weight of 557.87 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-N-[methoxy-[2,4,6-tri(propan-2-yl)phenyl]phosphinothioyl]aniline.
| Compound Name | 2,4,6-tritert-butyl-N-[methoxy-[2,4,6-tri(propan-2-yl)phenyl]phosphinothioyl]aniline |
|---|---|
| PubChem CID | 2830102 |
| Molecular Formula | C34H56NOPS |
| Molecular Weight | 557.87 g/mol |
| Exact Mass | 557.38 |
| IUPAC Name | 2,4,6-tritert-butyl-N-[methoxy-[2,4,6-tri(propan-2-yl)phenyl]phosphinothioyl]aniline |
| SMILES | COP(=S)(Nc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C34H56NOPS/c1-21(2)24-17-26(22(3)4)31(27(18-24)23(5)6)37(38,36-16)35-30-28(33(10,11)12)19-25(32(7,8)9)20-29(30)34(13,14)15/h17-23H,1-16H3,(H,35,38) |
| InChIKey | JVSUJIPUTHLBEU-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.87 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|