C45H62O3S2 — CID 87415617
[tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 87415617) has the molecular formula C45H62O3S2 and a molecular weight of 715.12 g/mol. Its IUPAC name is [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 87415617 |
| Molecular Formula | C45H62O3S2 |
| Molecular Weight | 715.12 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)OS(c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C45H62O3S2/c1-30(2)33-28-40(31(3)4)42(41(29-33)32(5)6)50(46,47)48-49(37-22-16-34(17-23-37)43(7,8)9,38-24-18-35(19-25-38)44(10,11)12)39-26-20-36(21-27-39)45(13,14)15/h16-32H,1-15H3 |
| InChIKey | QVKYPUJKLOVDID-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.12 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |