C36H39F5O3S2 — CID 87832226
[tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 87832226) has the molecular formula C36H39F5O3S2 and a molecular weight of 678.83 g/mol. Its IUPAC name is [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 87832226 |
| Molecular Formula | C36H39F5O3S2 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H39F5O3S2/c1-34(2,3)22-10-16-25(17-11-22)45(26-18-12-23(13-19-26)35(4,5)6,27-20-14-24(15-21-27)36(7,8)9)44-46(42,43)33-31(40)29(38)28(37)30(39)32(33)41/h10-21H,1-9H3 |
| InChIKey | BBQCSHJUILQEPZ-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|