C64H78F6O5S3 — CID 87387967
[tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,2,3,3,4,4-hexafluoro-4-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylbutanoate (PubChem CID 87387967) has the molecular formula C64H78F6O5S3 and a molecular weight of 1137.51 g/mol. Its IUPAC name is [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,2,3,3,4,4-hexafluoro-4-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylbutanoate.
| Compound Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,2,3,3,4,4-hexafluoro-4-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylbutanoate |
|---|---|
| PubChem CID | 87387967 |
| Molecular Formula | C64H78F6O5S3 |
| Molecular Weight | 1137.51 g/mol |
| Exact Mass | 1136.49 |
| IUPAC Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 2,2,3,3,4,4-hexafluoro-4-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylbutanoate |
| SMILES | CC(C)(C)c1ccc(S(OC(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OS(c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C64H78F6O5S3/c1-56(2,3)43-19-31-49(32-20-43)76(50-33-21-44(22-34-50)57(4,5)6,51-35-23-45(24-36-51)58(7,8)9)74-55(71)62(65,66)63(67,68)64(69,70)78(72,73)75-77(52-37-25-46(26-38-52)59(10,11)12,53-39-27-47(28-40-53)60(13,14)15)54-41-29-48(30-42-54)61(16,17)18/h19-42H,1-18H3 |
| InChIKey | HCEPMTRQTYEJRR-UHFFFAOYSA-N |
| XLogP | 19.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1137.51 |
| LogP ≤ 5 | 19.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|