C25H25F3O5S2 — CID 139810607
[4-[diphenyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 139810607) has the molecular formula C25H25F3O5S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is [4-[diphenyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[diphenyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 139810607 |
| Molecular Formula | C25H25F3O5S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [4-[diphenyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25F3O5S2/c1-24(2,3)18-23(29)32-19-14-16-22(17-15-19)34(20-10-6-4-7-11-20,21-12-8-5-9-13-21)33-35(30,31)25(26,27)28/h4-17H,18H2,1-3H3 |
| InChIKey | PXLTUJIVSZRMNW-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|