C28H24F5O3S2+ — CID 91006333
[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium (PubChem CID 91006333) has the molecular formula C28H24F5O3S2+ and a molecular weight of 567.62 g/mol. Its IUPAC name is [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium.
| Compound Name | [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 91006333 |
| Molecular Formula | C28H24F5O3S2+ |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium |
| SMILES | CC(C)(C)c1ccc(S([OH+]S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23F5O3S2/c1-28(2,3)18-14-16-21(17-15-18)37(19-10-6-4-7-11-19,20-12-8-5-9-13-20)36-38(34,35)27-25(32)23(30)22(29)24(31)26(27)33/h4-17H,1-3H3/p+1 |
| InChIKey | MEHBREMAQKXPAQ-UHFFFAOYSA-O |
| XLogP | 8.36 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|