C28H24F5O4S2+ — CID 57185444
[[3-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium (PubChem CID 57185444) has the molecular formula C28H24F5O4S2+ and a molecular weight of 583.62 g/mol. Its IUPAC name is [[3-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium.
| Compound Name | [[3-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 57185444 |
| Molecular Formula | C28H24F5O4S2+ |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | [[3-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonyloxidanium |
| SMILES | CC(C)(C)Oc1cccc(S([OH+]S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H23F5O4S2/c1-28(2,3)36-18-11-10-16-21(17-18)38(19-12-6-4-7-13-19,20-14-8-5-9-15-20)37-39(34,35)27-25(32)23(30)22(29)24(31)26(27)33/h4-17H,1-3H3/p+1 |
| InChIKey | RFVZBGDEICRCFS-UHFFFAOYSA-O |
| XLogP | 8.24 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|