C39H40F5O12S2+ — CID 57005930
(2,3,4,5,6-pentafluorophenyl)sulfonyl-[tris[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl]oxidanium (PubChem CID 57005930) has the molecular formula C39H40F5O12S2+ and a molecular weight of 859.86 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)sulfonyl-[tris[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl]oxidanium.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)sulfonyl-[tris[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 57005930 |
| Molecular Formula | C39H40F5O12S2+ |
| Molecular Weight | 859.86 g/mol |
| Exact Mass | 859.19 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)sulfonyl-[tris[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl]oxidanium |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(S([OH+]S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccc(OC(=O)OC(C)(C)C)cc2)c2ccc(OC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C39H39F5O12S2/c1-37(2,3)53-34(45)50-22-10-16-25(17-11-22)57(26-18-12-23(13-19-26)51-35(46)54-38(4,5)6,27-20-14-24(15-21-27)52-36(47)55-39(7,8)9)56-58(48,49)33-31(43)29(41)28(40)30(42)32(33)44/h10-21H,1-9H3/p+1 |
| InChIKey | GENWBJXNDCMGGZ-UHFFFAOYSA-O |
| XLogP | 11.00 |
| TPSA | 153.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.86 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|