C14H22O6S2 — CID 139649411
[dimethyl-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] methanesulfonate (PubChem CID 139649411) has the molecular formula C14H22O6S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [dimethyl-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] methanesulfonate.
| Compound Name | [dimethyl-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] methanesulfonate |
|---|---|
| PubChem CID | 139649411 |
| Molecular Formula | C14H22O6S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [dimethyl-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-λ4-sulfanyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(S(C)(C)OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22O6S2/c1-14(2,3)19-13(15)18-11-7-9-12(10-8-11)21(4,5)20-22(6,16)17/h7-10H,1-6H3 |
| InChIKey | QLBZCAUFGAVSHU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|