C29H34O9S2 — CID 57092327
[bis[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenyl-λ4-sulfanyl] methanesulfonate (PubChem CID 57092327) has the molecular formula C29H34O9S2 and a molecular weight of 590.72 g/mol. Its IUPAC name is [bis[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenyl-λ4-sulfanyl] methanesulfonate.
| Compound Name | [bis[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenyl-λ4-sulfanyl] methanesulfonate |
|---|---|
| PubChem CID | 57092327 |
| Molecular Formula | C29H34O9S2 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | [bis[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-phenyl-λ4-sulfanyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(S(OS(C)(=O)=O)(c2ccccc2)c2cccc(OC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C29H34O9S2/c1-28(2,3)36-26(30)34-21-13-11-17-24(19-21)40(38-39(7,32)33,23-15-9-8-10-16-23)25-18-12-14-22(20-25)35-27(31)37-29(4,5)6/h8-20H,1-7H3 |
| InChIKey | UMKWALCPLFTQMT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|