About [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate
[(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate (PubChem CID 171802837) has the molecular formula C21H22O4S2
and a molecular weight of 402.54 g/mol. Its IUPAC name is [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate.
Molecular Properties
| Compound Name | [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate |
| PubChem CID | 171802837 |
| Molecular Formula | C21H22O4S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate |
| SMILES | Cc1cc(S(OS(C)(=O)=O)(c2ccccc2)c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C21H22O4S2/c1-16-14-20(15-17(2)21(16)22)27(25-26(3,23)24,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15,22H,1-3H3 |
| InChIKey | INTXXQUGBCAYID-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate?
The IUPAC name of [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate (CID 171802837) is [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate.
What is the SMILES notation for [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate?
The canonical SMILES for [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate is Cc1cc(S(OS(C)(=O)=O)(c2ccccc2)c2ccccc2)cc(C)c1O.
What is the InChIKey of [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate?
The InChIKey is INTXXQUGBCAYID-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O4S2/c1-16-14-20(15-17(2)21(16)22)27(25-26(3,23)24,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15,22H,1-3H3.
What are the key properties of [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate?
[(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate has a molecular weight of 402.54 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-hydroxy-3,5-dimethylphenyl)-diphenyl-λ4-sulfanyl] methanesulfonate is sourced from PubChem (CID 171802837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).