About [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate
[bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate (PubChem CID 57050758) has the molecular formula C27H26O4S2
and a molecular weight of 478.64 g/mol. Its IUPAC name is [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate.
Molecular Properties
| Compound Name | [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate |
| PubChem CID | 57050758 |
| Molecular Formula | C27H26O4S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate |
| SMILES | Cc1ccc(S(OS(C)(=O)=O)(c2ccc(C)cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H26O4S2/c1-21-9-15-25(16-10-21)33(31-32(3,28)29,26-17-11-22(2)12-18-26)27-19-13-24(14-20-27)30-23-7-5-4-6-8-23/h4-20H,1-3H3 |
| InChIKey | RXLSGWWIFLVZIB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate?
The IUPAC name of [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate (CID 57050758) is [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate.
What is the SMILES notation for [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate?
The canonical SMILES for [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate is Cc1ccc(S(OS(C)(=O)=O)(c2ccc(C)cc2)c2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate?
The InChIKey is RXLSGWWIFLVZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26O4S2/c1-21-9-15-25(16-10-21)33(31-32(3,28)29,26-17-11-22(2)12-18-26)27-19-13-24(14-20-27)30-23-7-5-4-6-8-23/h4-20H,1-3H3.
What are the key properties of [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate?
[bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate has a molecular weight of 478.64 g/mol, XLogP of 7.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(4-methylphenyl)-(4-phenoxyphenyl)-λ4-sulfanyl] methanesulfonate is sourced from PubChem (CID 57050758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).