C20H18O3S — CID 59330915
1,4-dimethyl-2-(4-phenoxyphenyl)sulfonylbenzene (PubChem CID 59330915) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1,4-dimethyl-2-(4-phenoxyphenyl)sulfonylbenzene.
| Compound Name | 1,4-dimethyl-2-(4-phenoxyphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 59330915 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1,4-dimethyl-2-(4-phenoxyphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(C)c(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C20H18O3S/c1-15-8-9-16(2)20(14-15)24(21,22)19-12-10-18(11-13-19)23-17-6-4-3-5-7-17/h3-14H,1-2H3 |
| InChIKey | BFUKIWSNDJQLMF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |