C50H48O10S2 — CID 139785754
[bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139785754) has the molecular formula C50H48O10S2 and a molecular weight of 873.06 g/mol. Its IUPAC name is [bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139785754 |
| Molecular Formula | C50H48O10S2 |
| Molecular Weight | 873.06 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | [bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OS(c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)(c2ccc(OC(=O)OC(C)(C)C)cc2)c2ccc(OC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H48O10S2/c1-34-16-24-43(25-17-34)62(53,54)60-61(41-28-20-38(21-29-41)56-47(51)58-49(2,3)4,42-30-22-39(23-31-42)57-48(52)59-50(5,6)7)40-26-18-37(19-27-40)55-33-36-32-35-12-8-9-13-44(35)46-15-11-10-14-45(36)46/h8-32H,33H2,1-7H3 |
| InChIKey | GKNDNMQPIWRYKL-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.06 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|