About benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium
benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium (PubChem CID 91335174) has the molecular formula C25H23O3S2+
and a molecular weight of 435.59 g/mol. Its IUPAC name is benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium.
Molecular Properties
| Compound Name | benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium |
| PubChem CID | 91335174 |
| Molecular Formula | C25H23O3S2+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium |
| SMILES | Cc1ccc(S([OH+]S(=O)(=O)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22O3S2/c1-21-17-19-24(20-18-21)29(22-11-5-2-6-12-22,23-13-7-3-8-14-23)28-30(26,27)25-15-9-4-10-16-25/h2-20H,1H3/p+1 |
| InChIKey | GNOQTHPTWGCWRJ-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium?
The IUPAC name of benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium (CID 91335174) is benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium.
What is the SMILES notation for benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium?
The canonical SMILES for benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium is Cc1ccc(S([OH+]S(=O)(=O)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium?
The InChIKey is GNOQTHPTWGCWRJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H22O3S2/c1-21-17-19-24(20-18-21)29(22-11-5-2-6-12-22,23-13-7-3-8-14-23)28-30(26,27)25-15-9-4-10-16-25/h2-20H,1H3/p+1.
What are the key properties of benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium?
benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium has a molecular weight of 435.59 g/mol, XLogP of 6.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonyl-[(4-methylphenyl)-diphenyl-λ4-sulfanyl]oxidanium is sourced from PubChem (CID 91335174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).