About (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium
(4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium (PubChem CID 57058311) has the molecular formula C28H29O3S2+
and a molecular weight of 477.67 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium.
Molecular Properties
| Compound Name | (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium |
| PubChem CID | 57058311 |
| Molecular Formula | C28H29O3S2+ |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium |
| SMILES | Cc1ccc(S(=O)(=O)[OH+]S(Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28O3S2/c1-24-17-19-28(20-18-24)33(29,30)31-32(21-25-11-5-2-6-12-25,22-26-13-7-3-8-14-26)23-27-15-9-4-10-16-27/h2-20H,21-23H2,1H3/p+1 |
| InChIKey | PSNGEZRNOVSTDD-UHFFFAOYSA-O |
| XLogP | 7.10 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium?
The IUPAC name of (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium (CID 57058311) is (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium.
What is the SMILES notation for (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium?
The canonical SMILES for (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium is Cc1ccc(S(=O)(=O)[OH+]S(Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium?
The InChIKey is PSNGEZRNOVSTDD-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H28O3S2/c1-24-17-19-28(20-18-24)33(29,30)31-32(21-25-11-5-2-6-12-25,22-26-13-7-3-8-14-26)23-27-15-9-4-10-16-27/h2-20H,21-23H2,1H3/p+1.
What are the key properties of (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium?
(4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium has a molecular weight of 477.67 g/mol, XLogP of 7.10, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)sulfonyl-(tribenzyl-λ4-sulfanyl)oxidanium is sourced from PubChem (CID 57058311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).