About [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium
[dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 57250454) has the molecular formula C15H19O3S2+
and a molecular weight of 311.45 g/mol. Its IUPAC name is [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
Molecular Properties
| Compound Name | [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| PubChem CID | 57250454 |
| Molecular Formula | C15H19O3S2+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | Cc1ccc(S(=O)(=O)[OH+]S(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H18O3S2/c1-13-9-11-15(12-10-13)20(16,17)18-19(2,3)14-7-5-4-6-8-14/h4-12H,1-3H3/p+1 |
| InChIKey | NVRCSWMEOVSVOU-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The IUPAC name of [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (CID 57250454) is [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
What is the SMILES notation for [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The canonical SMILES for [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium is Cc1ccc(S(=O)(=O)[OH+]S(C)(C)c2ccccc2)cc1.
What is the InChIKey of [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The InChIKey is NVRCSWMEOVSVOU-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H18O3S2/c1-13-9-11-15(12-10-13)20(16,17)18-19(2,3)14-7-5-4-6-8-14/h4-12H,1-3H3/p+1.
What are the key properties of [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
[dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium has a molecular weight of 311.45 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(phenyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium is sourced from PubChem (CID 57250454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).