C13H14F9O3S2+ — CID 91539256
[dimethyl-(4-methylphenyl)-λ4-sulfanyl]-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)oxidanium (PubChem CID 91539256) has the molecular formula C13H14F9O3S2+ and a molecular weight of 453.37 g/mol. Its IUPAC name is [dimethyl-(4-methylphenyl)-λ4-sulfanyl]-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)oxidanium.
| Compound Name | [dimethyl-(4-methylphenyl)-λ4-sulfanyl]-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 91539256 |
| Molecular Formula | C13H14F9O3S2+ |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | [dimethyl-(4-methylphenyl)-λ4-sulfanyl]-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)oxidanium |
| SMILES | Cc1ccc(S(C)(C)[OH+]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F9O3S2/c1-8-4-6-9(7-5-8)26(2,3)25-27(23,24)13(21,22)11(16,17)10(14,15)12(18,19)20/h4-7H,1-3H3/p+1 |
| InChIKey | KTPFQUOIHOCABC-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|