C15H15F9O3S2 — CID 139931299
[1-(4-methylphenyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139931299) has the molecular formula C15H15F9O3S2 and a molecular weight of 478.40 g/mol. Its IUPAC name is [1-(4-methylphenyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-(4-methylphenyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139931299 |
| Molecular Formula | C15H15F9O3S2 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | [1-(4-methylphenyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC2)cc1 |
| InChI | InChI=1S/C15H15F9O3S2/c1-10-4-6-11(7-5-10)28(8-2-3-9-28)27-29(25,26)15(23,24)13(18,19)12(16,17)14(20,21)22/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | RJAOLLXKFPBUFW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|