C23H23F9O4S2 — CID 87760675
[1-(6-cyclopentyloxynaphthalen-2-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87760675) has the molecular formula C23H23F9O4S2 and a molecular weight of 598.55 g/mol. Its IUPAC name is [1-(6-cyclopentyloxynaphthalen-2-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-(6-cyclopentyloxynaphthalen-2-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87760675 |
| Molecular Formula | C23H23F9O4S2 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | [1-(6-cyclopentyloxynaphthalen-2-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OS1(c2ccc3cc(OC4CCCC4)ccc3c2)CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H23F9O4S2/c24-20(25,22(28,29)30)21(26,27)23(31,32)38(33,34)36-37(11-3-4-12-37)19-10-8-15-13-18(9-7-16(15)14-19)35-17-5-1-2-6-17/h7-10,13-14,17H,1-6,11-12H2 |
| InChIKey | WWECHVZMOQSRGH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|