C17H19F3O4S2 — CID 18350149
1-(6-ethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate (PubChem CID 18350149) has the molecular formula C17H19F3O4S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-(6-ethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-(6-ethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18350149 |
| Molecular Formula | C17H19F3O4S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(6-ethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
| SMILES | CCOc1ccc2c([S+]3CCCC3)cccc2c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H19OS.CHF3O3S/c1-2-17-14-8-9-15-13(12-14)6-5-7-16(15)18-10-3-4-11-18;2-1(3,4)8(5,6)7/h5-9,12H,2-4,10-11H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HGQSBQPGPGOZMM-UHFFFAOYSA-M |
| XLogP | 4.06 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|