C13H17F3O3S2 — CID 140529934
[1-(4-methylphenyl)thian-1-yl] trifluoromethanesulfonate (PubChem CID 140529934) has the molecular formula C13H17F3O3S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is [1-(4-methylphenyl)thian-1-yl] trifluoromethanesulfonate.
| Compound Name | [1-(4-methylphenyl)thian-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140529934 |
| Molecular Formula | C13H17F3O3S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [1-(4-methylphenyl)thian-1-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S2(OS(=O)(=O)C(F)(F)F)CCCCC2)cc1 |
| InChI | InChI=1S/C13H17F3O3S2/c1-11-5-7-12(8-6-11)20(9-3-2-4-10-20)19-21(17,18)13(14,15)16/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | RCIQBZRQHXVFQB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|