C20H21F3O3S2 — CID 176903513
[1-[2-(2-methylphenyl)-2-phenylethenyl]thiolan-1-yl] trifluoromethanesulfonate (PubChem CID 176903513) has the molecular formula C20H21F3O3S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is [1-[2-(2-methylphenyl)-2-phenylethenyl]thiolan-1-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-(2-methylphenyl)-2-phenylethenyl]thiolan-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176903513 |
| Molecular Formula | C20H21F3O3S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [1-[2-(2-methylphenyl)-2-phenylethenyl]thiolan-1-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccccc1C(=CS1(OS(=O)(=O)C(F)(F)F)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H21F3O3S2/c1-16-9-5-6-12-18(16)19(17-10-3-2-4-11-17)15-27(13-7-8-14-27)26-28(24,25)20(21,22)23/h2-6,9-12,15H,7-8,13-14H2,1H3 |
| InChIKey | UURMJGMEIXZALQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|