C16H25F3O4S2Si — CID 134926042
[3-(4-methylphenyl)-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate (PubChem CID 134926042) has the molecular formula C16H25F3O4S2Si and a molecular weight of 430.59 g/mol. Its IUPAC name is [3-(4-methylphenyl)-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate.
| Compound Name | [3-(4-methylphenyl)-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134926042 |
| Molecular Formula | C16H25F3O4S2Si |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [3-(4-methylphenyl)-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C2COCCS2(C[Si](C)(C)C)OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H25F3O4S2Si/c1-13-5-7-14(8-6-13)15-11-22-9-10-24(15,12-26(2,3)4)23-25(20,21)16(17,18)19/h5-8,15H,9-12H2,1-4H3 |
| InChIKey | MRKMTXCZXJMZQU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|