C10H9F6IO3S — CID 134874632
[(4-methylphenyl)-(2,2,2-trifluoroethyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134874632) has the molecular formula C10H9F6IO3S and a molecular weight of 450.14 g/mol. Its IUPAC name is [(4-methylphenyl)-(2,2,2-trifluoroethyl)-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [(4-methylphenyl)-(2,2,2-trifluoroethyl)-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134874632 |
| Molecular Formula | C10H9F6IO3S |
| Molecular Weight | 450.14 g/mol |
| Exact Mass | 449.92 |
| IUPAC Name | [(4-methylphenyl)-(2,2,2-trifluoroethyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(I(CC(F)(F)F)OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F6IO3S/c1-7-2-4-8(5-3-7)17(6-9(11,12)13)20-21(18,19)10(14,15)16/h2-5H,6H2,1H3 |
| InChIKey | FOSZKVNCOMZSAS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|