C16H15F8IO3S2 — CID 122376914
[[4-(pentafluoro-λ6-sulfanyl)phenyl]-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 122376914) has the molecular formula C16H15F8IO3S2 and a molecular weight of 598.32 g/mol. Its IUPAC name is [[4-(pentafluoro-λ6-sulfanyl)phenyl]-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [[4-(pentafluoro-λ6-sulfanyl)phenyl]-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122376914 |
| Molecular Formula | C16H15F8IO3S2 |
| Molecular Weight | 598.32 g/mol |
| Exact Mass | 597.94 |
| IUPAC Name | [[4-(pentafluoro-λ6-sulfanyl)phenyl]-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(I(OS(=O)(=O)C(F)(F)F)c2ccc(S(F)(F)(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C16H15F8IO3S2/c1-10-8-11(2)15(12(3)9-10)25(28-29(26,27)16(17,18)19)13-4-6-14(7-5-13)30(20,21,22,23)24/h4-9H,1-3H3 |
| InChIKey | FQESVCXLYUGVQP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.32 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|