C16H16F3IO3S — CID 15046624
[phenyl-(2,4,6-trimethylphenyl)-lambda3-iodanyl] trifluoromethanesulfonate (PubChem CID 15046624) has the molecular formula C16H16F3IO3S and a molecular weight of 472.27 g/mol. Its IUPAC name is [phenyl-(2,4,6-trimethylphenyl)-lambda3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [phenyl-(2,4,6-trimethylphenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15046624 |
| Molecular Formula | C16H16F3IO3S |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | [phenyl-(2,4,6-trimethylphenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16F3IO3S/c1-11-9-12(2)15(13(3)10-11)20(14-7-5-4-6-8-14)23-24(21,22)16(17,18)19/h4-10H,1-3H3 |
| InChIKey | FSDRYJHXLHKJID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|