C9H9F3INO4S — CID 14764337
[acetamido(phenyl)-lambda3-iodanyl] trifluoromethanesulfonate (PubChem CID 14764337) has the molecular formula C9H9F3INO4S and a molecular weight of 411.14 g/mol. Its IUPAC name is [acetamido(phenyl)-lambda3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [acetamido(phenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14764337 |
| Molecular Formula | C9H9F3INO4S |
| Molecular Weight | 411.14 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | [acetamido(phenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
| SMILES | CC(=O)NI(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H9F3INO4S/c1-7(15)14-13(8-5-3-2-4-6-8)18-19(16,17)9(10,11)12/h2-6H,1H3,(H,14,15) |
| InChIKey | JTHFDRLRESAGLZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|