About ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate
ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate (PubChem CID 162570557) has the molecular formula C11H12F3IN2O5S
and a molecular weight of 468.19 g/mol. Its IUPAC name is ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate |
| PubChem CID | 162570557 |
| Molecular Formula | C11H12F3IN2O5S |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate |
| SMILES | CCOC(=O)C(=NN)I(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H12F3IN2O5S/c1-2-21-10(18)9(17-16)15(8-6-4-3-5-7-8)22-23(19,20)11(12,13)14/h3-7H,2,16H2,1H3 |
| InChIKey | FTYKXGVPWQWKIT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate?
The IUPAC name of ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate (CID 162570557) is ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate.
What is the SMILES notation for ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate?
The canonical SMILES for ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate is CCOC(=O)C(=NN)I(OS(=O)(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate?
The InChIKey is FTYKXGVPWQWKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3IN2O5S/c1-2-21-10(18)9(17-16)15(8-6-4-3-5-7-8)22-23(19,20)11(12,13)14/h3-7H,2,16H2,1H3.
What are the key properties of ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate?
ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate has a molecular weight of 468.19 g/mol, XLogP of 1.98, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydrazinylidene-2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]acetate is sourced from PubChem (CID 162570557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).