About [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate
[dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134875245) has the molecular formula C17H22F3IO3S
and a molecular weight of 490.33 g/mol. Its IUPAC name is [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 134875245 |
| Molecular Formula | C17H22F3IO3S |
| Molecular Weight | 490.33 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | CCCCCCCCC#CI(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H22F3IO3S/c1-2-3-4-5-6-7-8-12-15-21(16-13-10-9-11-14-16)24-25(22,23)17(18,19)20/h9-11,13-14H,2-8H2,1H3 |
| InChIKey | QMCVOBLBJNUZNC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate (CID 134875245) is [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate is CCCCCCCCC#CI(OS(=O)(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is QMCVOBLBJNUZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F3IO3S/c1-2-3-4-5-6-7-8-12-15-21(16-13-10-9-11-14-16)24-25(22,23)17(18,19)20/h9-11,13-14H,2-8H2,1H3.
What are the key properties of [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate?
[dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 490.33 g/mol, XLogP of 5.86, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dec-1-ynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 134875245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).