C15H16F3IO6S — CID 134878268
[4-(1,3-dioxan-2-yloxy)but-1-ynyl-phenyl-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134878268) has the molecular formula C15H16F3IO6S and a molecular weight of 508.25 g/mol. Its IUPAC name is [4-(1,3-dioxan-2-yloxy)but-1-ynyl-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [4-(1,3-dioxan-2-yloxy)but-1-ynyl-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134878268 |
| Molecular Formula | C15H16F3IO6S |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 507.97 |
| IUPAC Name | [4-(1,3-dioxan-2-yloxy)but-1-ynyl-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(C#CCCOC1OCCCO1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3IO6S/c16-15(17,18)26(20,21)25-19(13-7-2-1-3-8-13)9-4-5-10-22-14-23-11-6-12-24-14/h1-3,7-8,14H,5-6,10-12H2 |
| InChIKey | FEHRCYUCEMTJCD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|