C22H17F3INO4S — CID 135023337
[[(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenyl-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 135023337) has the molecular formula C22H17F3INO4S and a molecular weight of 575.35 g/mol. Its IUPAC name is [[(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [[(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135023337 |
| Molecular Formula | C22H17F3INO4S |
| Molecular Weight | 575.35 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | [[(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(c1ccccc1)[C@@H]1N=C(c2ccccc2)O[C@H]1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H17F3INO4S/c23-22(24,25)32(28,29)31-26(18-14-8-3-9-15-18)20-19(16-10-4-1-5-11-16)30-21(27-20)17-12-6-2-7-13-17/h1-15,19-20H/t19-,20+/m0/s1 |
| InChIKey | ADTKMLAXOHWBFF-VQTJNVASSA-N |
| XLogP | 5.69 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|