C11H9F6IO7S2 — CID 134930402
[(E)-3-hydroxy-1-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 134930402) has the molecular formula C11H9F6IO7S2 and a molecular weight of 558.21 g/mol. Its IUPAC name is [(E)-3-hydroxy-1-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(E)-3-hydroxy-1-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134930402 |
| Molecular Formula | C11H9F6IO7S2 |
| Molecular Weight | 558.21 g/mol |
| Exact Mass | 557.87 |
| IUPAC Name | [(E)-3-hydroxy-1-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/C(=C/I(OS(=O)(=O)C(F)(F)F)c1ccccc1)CO)C(F)(F)F |
| InChI | InChI=1S/C11H9F6IO7S2/c12-10(13,14)26(20,21)24-9(7-19)6-18(8-4-2-1-3-5-8)25-27(22,23)11(15,16)17/h1-6,19H,7H2/b9-6+ |
| InChIKey | HVALLZZBPCGHDP-RMKNXTFCSA-N |
| XLogP | 2.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|