C24H14F6I2O6S2 — CID 134904961
[phenyl-[2-[4-[2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]ethynyl]phenyl]ethynyl]-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134904961) has the molecular formula C24H14F6I2O6S2 and a molecular weight of 830.30 g/mol. Its IUPAC name is [phenyl-[2-[4-[2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]ethynyl]phenyl]ethynyl]-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [phenyl-[2-[4-[2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]ethynyl]phenyl]ethynyl]-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134904961 |
| Molecular Formula | C24H14F6I2O6S2 |
| Molecular Weight | 830.30 g/mol |
| Exact Mass | 829.82 |
| IUPAC Name | [phenyl-[2-[4-[2-[phenyl(trifluoromethylsulfonyloxy)-λ3-iodanyl]ethynyl]phenyl]ethynyl]-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(C#Cc1ccc(C#CI(OS(=O)(=O)C(F)(F)F)c2ccccc2)cc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H14F6I2O6S2/c25-23(26,27)39(33,34)37-31(21-7-3-1-4-8-21)17-15-19-11-13-20(14-12-19)16-18-32(22-9-5-2-6-10-22)38-40(35,36)24(28,29)30/h1-14H |
| InChIKey | JPOXSHCPSARGDN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.30 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|