About [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate
[phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate (PubChem CID 10873062) has the molecular formula C15H13IO3S
and a molecular weight of 400.24 g/mol. Its IUPAC name is [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate.
Molecular Properties
| Compound Name | [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate |
| PubChem CID | 10873062 |
| Molecular Formula | C15H13IO3S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate |
| SMILES | CS(=O)(=O)OI(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13IO3S/c1-20(17,18)19-16(15-10-6-3-7-11-15)13-12-14-8-4-2-5-9-14/h2-11H,1H3 |
| InChIKey | HVDUKNKIVXNKSQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate?
The IUPAC name of [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate (CID 10873062) is [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate.
What is the SMILES notation for [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate?
The canonical SMILES for [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate is CS(=O)(=O)OI(C#Cc1ccccc1)c1ccccc1.
What is the InChIKey of [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate?
The InChIKey is HVDUKNKIVXNKSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13IO3S/c1-20(17,18)19-16(15-10-6-3-7-11-15)13-12-14-8-4-2-5-9-14/h2-11H,1H3.
What are the key properties of [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate?
[phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate has a molecular weight of 400.24 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [phenyl(2-phenylethynyl)-λ3-iodanyl] methanesulfonate is sourced from PubChem (CID 10873062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).