About [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate
[pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate (PubChem CID 134894122) has the molecular formula C12H15IO3S
and a molecular weight of 366.22 g/mol. Its IUPAC name is [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate.
Molecular Properties
| Compound Name | [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate |
| PubChem CID | 134894122 |
| Molecular Formula | C12H15IO3S |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate |
| SMILES | CCCC#CI(OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C12H15IO3S/c1-3-4-8-11-13(16-17(2,14)15)12-9-6-5-7-10-12/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | STZXLUPGLHPXOM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate?
The IUPAC name of [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate (CID 134894122) is [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate.
What is the SMILES notation for [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate?
The canonical SMILES for [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate is CCCC#CI(OS(C)(=O)=O)c1ccccc1.
What is the InChIKey of [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate?
The InChIKey is STZXLUPGLHPXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IO3S/c1-3-4-8-11-13(16-17(2,14)15)12-9-6-5-7-10-12/h5-7,9-10H,3-4H2,1-2H3.
What are the key properties of [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate?
[pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate has a molecular weight of 366.22 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [pent-1-ynyl(phenyl)-λ3-iodanyl] methanesulfonate is sourced from PubChem (CID 134894122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).