About 1-bromohex-2-ynylbenzene
1-bromohex-2-ynylbenzene (PubChem CID 164887667) has the molecular formula C12H13Br
and a molecular weight of 237.14 g/mol. Its IUPAC name is 1-bromohex-2-ynylbenzene.
Molecular Properties
| Compound Name | 1-bromohex-2-ynylbenzene |
| PubChem CID | 164887667 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-bromohex-2-ynylbenzene |
| SMILES | CCCC#CC(Br)c1ccccc1 |
| InChI | InChI=1S/C12H13Br/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12H,2-3H2,1H3 |
| InChIKey | PAZSTTAZSMPESX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromohex-2-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromohex-2-ynylbenzene?
The IUPAC name of 1-bromohex-2-ynylbenzene (CID 164887667) is 1-bromohex-2-ynylbenzene.
What is the SMILES notation for 1-bromohex-2-ynylbenzene?
The canonical SMILES for 1-bromohex-2-ynylbenzene is CCCC#CC(Br)c1ccccc1.
What is the InChIKey of 1-bromohex-2-ynylbenzene?
The InChIKey is PAZSTTAZSMPESX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12H,2-3H2,1H3.
What are the key properties of 1-bromohex-2-ynylbenzene?
1-bromohex-2-ynylbenzene has a molecular weight of 237.14 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromohex-2-ynylbenzene is sourced from PubChem (CID 164887667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).