About 2-bromo-2-phenylacetonitrile;ethanol
2-bromo-2-phenylacetonitrile;ethanol (PubChem CID 174663547) has the molecular formula C10H12BrNO
and a molecular weight of 242.12 g/mol. Its IUPAC name is 2-bromo-2-phenylacetonitrile;ethanol.
Molecular Properties
| Compound Name | 2-bromo-2-phenylacetonitrile;ethanol |
| PubChem CID | 174663547 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-bromo-2-phenylacetonitrile;ethanol |
| SMILES | CCO.N#CC(Br)c1ccccc1 |
| InChI | InChI=1S/C8H6BrN.C2H6O/c9-8(6-10)7-4-2-1-3-5-7;1-2-3/h1-5,8H;3H,2H2,1H3 |
| InChIKey | VFTATQKJJRMPJJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-phenylacetonitrile;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-phenylacetonitrile;ethanol?
The IUPAC name of 2-bromo-2-phenylacetonitrile;ethanol (CID 174663547) is 2-bromo-2-phenylacetonitrile;ethanol.
What is the SMILES notation for 2-bromo-2-phenylacetonitrile;ethanol?
The canonical SMILES for 2-bromo-2-phenylacetonitrile;ethanol is CCO.N#CC(Br)c1ccccc1.
What is the InChIKey of 2-bromo-2-phenylacetonitrile;ethanol?
The InChIKey is VFTATQKJJRMPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN.C2H6O/c9-8(6-10)7-4-2-1-3-5-7;1-2-3/h1-5,8H;3H,2H2,1H3.
What are the key properties of 2-bromo-2-phenylacetonitrile;ethanol?
2-bromo-2-phenylacetonitrile;ethanol has a molecular weight of 242.12 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-phenylacetonitrile;ethanol is sourced from PubChem (CID 174663547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).