About ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate
ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate (PubChem CID 134935152) has the molecular formula C19H22INO5S
and a molecular weight of 503.36 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
| PubChem CID | 134935152 |
| Molecular Formula | C19H22INO5S |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(/C)N)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22INO5S/c1-4-25-19(22)18(15(3)21)20(16-8-6-5-7-9-16)26-27(23,24)17-12-10-14(2)11-13-17/h5-13H,4,21H2,1-3H3/b18-15+ |
| InChIKey | KFKIAMDBFKGZTK-OBGWFSINSA-N |
| XLogP | 3.74 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate?
The IUPAC name of ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate (CID 134935152) is ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate.
What is the SMILES notation for ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate?
The canonical SMILES for ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate is CCOC(=O)/C(=C(/C)N)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate?
The InChIKey is KFKIAMDBFKGZTK-OBGWFSINSA-N. The full InChI is InChI=1S/C19H22INO5S/c1-4-25-19(22)18(15(3)21)20(16-8-6-5-7-9-16)26-27(23,24)17-12-10-14(2)11-13-17/h5-13H,4,21H2,1-3H3/b18-15+.
What are the key properties of ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate?
ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate has a molecular weight of 503.36 g/mol, XLogP of 3.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-amino-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate is sourced from PubChem (CID 134935152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).