About [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate
[[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 134930329) has the molecular formula C21H27IO3S
and a molecular weight of 486.42 g/mol. Its IUPAC name is [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
| PubChem CID | 134930329 |
| Molecular Formula | C21H27IO3S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | CCCC/C(=C/I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1)CC |
| InChI | InChI=1S/C21H27IO3S/c1-4-6-10-19(5-2)17-22(20-11-8-7-9-12-20)25-26(23,24)21-15-13-18(3)14-16-21/h7-9,11-17H,4-6,10H2,1-3H3/b19-17+ |
| InChIKey | QJLRBQPPCYGFEH-HTXNQAPBSA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The IUPAC name of [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate (CID 134930329) is [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate is CCCC/C(=C/I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1)CC.
What is the InChIKey of [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The InChIKey is QJLRBQPPCYGFEH-HTXNQAPBSA-N. The full InChI is InChI=1S/C21H27IO3S/c1-4-6-10-19(5-2)17-22(20-11-8-7-9-12-20)25-26(23,24)21-15-13-18(3)14-16-21/h7-9,11-17H,4-6,10H2,1-3H3/b19-17+.
What are the key properties of [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
[[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate has a molecular weight of 486.42 g/mol, XLogP of 6.48, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(E)-2-ethylhex-1-enyl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 134930329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).