About [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate
[ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 11727627) has the molecular formula C9H13IO4S
and a molecular weight of 344.17 g/mol. Its IUPAC name is [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate |
| PubChem CID | 11727627 |
| Molecular Formula | C9H13IO4S |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | CCI(O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H13IO4S/c1-3-10(11)14-15(12,13)9-6-4-8(2)5-7-9/h4-7,11H,3H2,1-2H3 |
| InChIKey | OSKGEMWVJYQQAH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate?
The IUPAC name of [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate (CID 11727627) is [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate is CCI(O)OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate?
The InChIKey is OSKGEMWVJYQQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13IO4S/c1-3-10(11)14-15(12,13)9-6-4-8(2)5-7-9/h4-7,11H,3H2,1-2H3.
What are the key properties of [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate?
[ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate has a molecular weight of 344.17 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(hydroxy)-λ3-iodanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 11727627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).