About [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate
[hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 140701951) has the molecular formula C13H12F5IO4S2
and a molecular weight of 518.26 g/mol. Its IUPAC name is [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate |
| PubChem CID | 140701951 |
| Molecular Formula | C13H12F5IO4S2 |
| Molecular Weight | 518.26 g/mol |
| Exact Mass | 517.91 |
| IUPAC Name | [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(O)c2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C13H12F5IO4S2/c1-10-2-6-12(7-3-10)24(21,22)23-19(20)11-4-8-13(9-5-11)25(14,15,16,17)18/h2-9,20H,1H3 |
| InChIKey | LXMUMRMDWIENQL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate?
The IUPAC name of [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate (CID 140701951) is [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OI(O)c2ccc(S(F)(F)(F)(F)F)cc2)cc1.
What is the InChIKey of [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate?
The InChIKey is LXMUMRMDWIENQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F5IO4S2/c1-10-2-6-12(7-3-10)24(21,22)23-19(20)11-4-8-13(9-5-11)25(14,15,16,17)18/h2-9,20H,1H3.
What are the key properties of [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate?
[hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate has a molecular weight of 518.26 g/mol, XLogP of 5.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy-[4-(pentafluoro-λ6-sulfanyl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 140701951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).