About [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate
[(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 134930140) has the molecular formula C18H17IO4S
and a molecular weight of 456.30 g/mol. Its IUPAC name is [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
| PubChem CID | 134930140 |
| Molecular Formula | C18H17IO4S |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(c2ccccc2)c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C18H17IO4S/c1-14-8-11-17(12-9-14)24(20,21)23-19(16-6-4-3-5-7-16)18-13-10-15(2)22-18/h3-13H,1-2H3 |
| InChIKey | KVKAGQRYRXZCTG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The IUPAC name of [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate (CID 134930140) is [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OI(c2ccccc2)c2ccc(C)o2)cc1.
What is the InChIKey of [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
The InChIKey is KVKAGQRYRXZCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17IO4S/c1-14-8-11-17(12-9-14)24(20,21)23-19(16-6-4-3-5-7-16)18-13-10-15(2)22-18/h3-13H,1-2H3.
What are the key properties of [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate?
[(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate has a molecular weight of 456.30 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-methylfuran-2-yl)-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 134930140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).