C28H35IO3S — CID 153461158
[phenyl-[2,4,6-tri(propan-2-yl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 153461158) has the molecular formula C28H35IO3S and a molecular weight of 578.56 g/mol. Its IUPAC name is [phenyl-[2,4,6-tri(propan-2-yl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [phenyl-[2,4,6-tri(propan-2-yl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 153461158 |
| Molecular Formula | C28H35IO3S |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [phenyl-[2,4,6-tri(propan-2-yl)phenyl]-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(c2ccccc2)c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1 |
| InChI | InChI=1S/C28H35IO3S/c1-19(2)23-17-26(20(3)4)28(27(18-23)21(5)6)29(24-11-9-8-10-12-24)32-33(30,31)25-15-13-22(7)14-16-25/h8-21H,1-7H3 |
| InChIKey | GHDBWJGKYDGXMC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|