C43H58O3S2 — CID 172866011
4-methylbenzenesulfonate;phenyl-bis[2,4,6-tri(propan-2-yl)phenyl]sulfanium (PubChem CID 172866011) has the molecular formula C43H58O3S2 and a molecular weight of 687.07 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;phenyl-bis[2,4,6-tri(propan-2-yl)phenyl]sulfanium.
| Compound Name | 4-methylbenzenesulfonate;phenyl-bis[2,4,6-tri(propan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 172866011 |
| Molecular Formula | C43H58O3S2 |
| Molecular Weight | 687.07 g/mol |
| Exact Mass | 686.38 |
| IUPAC Name | 4-methylbenzenesulfonate;phenyl-bis[2,4,6-tri(propan-2-yl)phenyl]sulfanium |
| SMILES | CC(C)c1cc(C(C)C)c([S+](c2ccccc2)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C36H51S.C7H8O3S/c1-22(2)28-18-31(24(5)6)35(32(19-28)25(7)8)37(30-16-14-13-15-17-30)36-33(26(9)10)20-29(23(3)4)21-34(36)27(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h13-27H,1-12H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | ZZSGQRFFFVIIES-UHFFFAOYSA-M |
| XLogP | 12.42 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.07 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|